C24H30N3O2S+ — CID 4530305
5-ethyl-6-oxo-N-(3-piperidin-1-ium-1-ylpropyl)benzo[b][1,4]benzothiazepine-3-carboxamide (PubChem CID 4530305) has the molecular formula C24H30N3O2S+ and a molecular weight of 424.59 g/mol. Its IUPAC name is 5-ethyl-6-oxo-N-(3-piperidin-1-ium-1-ylpropyl)benzo[b][1,4]benzothiazepine-3-carboxamide.
| Compound Name | 5-ethyl-6-oxo-N-(3-piperidin-1-ium-1-ylpropyl)benzo[b][1,4]benzothiazepine-3-carboxamide |
|---|---|
| PubChem CID | 4530305 |
| Molecular Formula | C24H30N3O2S+ |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | 5-ethyl-6-oxo-N-(3-piperidin-1-ium-1-ylpropyl)benzo[b][1,4]benzothiazepine-3-carboxamide |
| SMILES | CCN1C(=O)c2ccccc2Sc2ccc(C(=O)NCCC[NH+]3CCCCC3)cc21 |
| InChI | InChI=1S/C24H29N3O2S/c1-2-27-20-17-18(23(28)25-13-8-16-26-14-6-3-7-15-26)11-12-22(20)30-21-10-5-4-9-19(21)24(27)29/h4-5,9-12,17H,2-3,6-8,13-16H2,1H3,(H,25,28)/p+1 |
| InChIKey | FKCFYPUZVBMDED-UHFFFAOYSA-O |
| XLogP | 3.01 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|