C29H33N3O2S — CID 4077357
N-[3-(diethylamino)propyl]-5-[(4-methylphenyl)methyl]-6-oxobenzo[b][1,4]benzothiazepine-3-carboxamide (PubChem CID 4077357) has the molecular formula C29H33N3O2S and a molecular weight of 487.67 g/mol. Its IUPAC name is N-[3-(diethylamino)propyl]-5-[(4-methylphenyl)methyl]-6-oxobenzo[b][1,4]benzothiazepine-3-carboxamide.
| Compound Name | N-[3-(diethylamino)propyl]-5-[(4-methylphenyl)methyl]-6-oxobenzo[b][1,4]benzothiazepine-3-carboxamide |
|---|---|
| PubChem CID | 4077357 |
| Molecular Formula | C29H33N3O2S |
| Molecular Weight | 487.67 g/mol |
| Exact Mass | 487.23 |
| IUPAC Name | N-[3-(diethylamino)propyl]-5-[(4-methylphenyl)methyl]-6-oxobenzo[b][1,4]benzothiazepine-3-carboxamide |
| SMILES | CCN(CC)CCCNC(=O)c1ccc2c(c1)N(Cc1ccc(C)cc1)C(=O)c1ccccc1S2 |
| InChI | InChI=1S/C29H33N3O2S/c1-4-31(5-2)18-8-17-30-28(33)23-15-16-27-25(19-23)32(20-22-13-11-21(3)12-14-22)29(34)24-9-6-7-10-26(24)35-27/h6-7,9-16,19H,4-5,8,17-18,20H2,1-3H3,(H,30,33) |
| InChIKey | YJINTYSRKCFNOZ-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.67 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|