C24H28N2O2S — CID 4090601
4-benzyl-N-cyclooctyl-3-oxo-1,4-benzothiazine-6-carboxamide (PubChem CID 4090601) has the molecular formula C24H28N2O2S and a molecular weight of 408.57 g/mol. Its IUPAC name is 4-benzyl-N-cyclooctyl-3-oxo-1,4-benzothiazine-6-carboxamide.
| Compound Name | 4-benzyl-N-cyclooctyl-3-oxo-1,4-benzothiazine-6-carboxamide |
|---|---|
| PubChem CID | 4090601 |
| Molecular Formula | C24H28N2O2S |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | 4-benzyl-N-cyclooctyl-3-oxo-1,4-benzothiazine-6-carboxamide |
| SMILES | O=C(NC1CCCCCCC1)c1ccc2c(c1)N(Cc1ccccc1)C(=O)CS2 |
| InChI | InChI=1S/C24H28N2O2S/c27-23-17-29-22-14-13-19(24(28)25-20-11-7-2-1-3-8-12-20)15-21(22)26(23)16-18-9-5-4-6-10-18/h4-6,9-10,13-15,20H,1-3,7-8,11-12,16-17H2,(H,25,28) |
| InChIKey | OFJUKJQNIMANOW-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |