C19H18N2O2 — CID 53160635
1-benzyl-N-cyclopropyl-2-oxo-3H-indole-5-carboxamide (PubChem CID 53160635) has the molecular formula C19H18N2O2 and a molecular weight of 306.37 g/mol. Its IUPAC name is 1-benzyl-N-cyclopropyl-2-oxo-3H-indole-5-carboxamide.
| Compound Name | 1-benzyl-N-cyclopropyl-2-oxo-3H-indole-5-carboxamide |
|---|---|
| PubChem CID | 53160635 |
| Molecular Formula | C19H18N2O2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 1-benzyl-N-cyclopropyl-2-oxo-3H-indole-5-carboxamide |
| SMILES | O=C(NC1CC1)c1ccc2c(c1)CC(=O)N2Cc1ccccc1 |
| InChI | InChI=1S/C19H18N2O2/c22-18-11-15-10-14(19(23)20-16-7-8-16)6-9-17(15)21(18)12-13-4-2-1-3-5-13/h1-6,9-10,16H,7-8,11-12H2,(H,20,23) |
| InChIKey | ZHECNTDVYBVFDL-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |