C22H20N2O5 — CID 120678402
cis-(1R,3S)-3-[(2-benzyl-1,3-dioxoisoindole-5-carbonyl)amino]cyclopentane-1-carboxylic acid (PubChem CID 120678402) has the molecular formula C22H20N2O5 and a molecular weight of 392.41 g/mol. Its IUPAC name is cis-(1R,3S)-3-[(2-benzyl-1,3-dioxoisoindole-5-carbonyl)amino]cyclopentane-1-carboxylic acid.
| Compound Name | cis-(1R,3S)-3-[(2-benzyl-1,3-dioxoisoindole-5-carbonyl)amino]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 120678402 |
| Molecular Formula | C22H20N2O5 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | cis-(1R,3S)-3-[(2-benzyl-1,3-dioxoisoindole-5-carbonyl)amino]cyclopentane-1-carboxylic acid |
| SMILES | O=C(N[C@H]1CC[C@@H](C(=O)O)C1)c1ccc2c(c1)C(=O)N(Cc1ccccc1)C2=O |
| InChI | InChI=1S/C22H20N2O5/c25-19(23-16-8-6-15(10-16)22(28)29)14-7-9-17-18(11-14)21(27)24(20(17)26)12-13-4-2-1-3-5-13/h1-5,7,9,11,15-16H,6,8,10,12H2,(H,23,25)(H,28,29)/t15-,16+/m1/s1 |
| InChIKey | DYACWMLLKAPNSC-CVEARBPZSA-N |
| XLogP | 2.47 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|