C24H27N3O3 — CID 9292976
2-benzyl-1,3-dioxo-N-(1-propylpiperidin-4-yl)isoindole-5-carboxamide (PubChem CID 9292976) has the molecular formula C24H27N3O3 and a molecular weight of 405.50 g/mol. Its IUPAC name is 2-benzyl-1,3-dioxo-N-(1-propylpiperidin-4-yl)isoindole-5-carboxamide.
| Compound Name | 2-benzyl-1,3-dioxo-N-(1-propylpiperidin-4-yl)isoindole-5-carboxamide |
|---|---|
| PubChem CID | 9292976 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | 2-benzyl-1,3-dioxo-N-(1-propylpiperidin-4-yl)isoindole-5-carboxamide |
| SMILES | CCCN1CCC(NC(=O)c2ccc3c(c2)C(=O)N(Cc2ccccc2)C3=O)CC1 |
| InChI | InChI=1S/C24H27N3O3/c1-2-12-26-13-10-19(11-14-26)25-22(28)18-8-9-20-21(15-18)24(30)27(23(20)29)16-17-6-4-3-5-7-17/h3-9,15,19H,2,10-14,16H2,1H3,(H,25,28) |
| InChIKey | XAPXJOCLPYJGBN-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|