C19H24N2O4 — CID 78767376
2-butyl-N-(4-hydroxycyclohexyl)-1,3-dioxoisoindole-5-carboxamide (PubChem CID 78767376) has the molecular formula C19H24N2O4 and a molecular weight of 344.41 g/mol. Its IUPAC name is 2-butyl-N-(4-hydroxycyclohexyl)-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | 2-butyl-N-(4-hydroxycyclohexyl)-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 78767376 |
| Molecular Formula | C19H24N2O4 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 2-butyl-N-(4-hydroxycyclohexyl)-1,3-dioxoisoindole-5-carboxamide |
| SMILES | CCCCN1C(=O)c2ccc(C(=O)NC3CCC(O)CC3)cc2C1=O |
| InChI | InChI=1S/C19H24N2O4/c1-2-3-10-21-18(24)15-9-4-12(11-16(15)19(21)25)17(23)20-13-5-7-14(22)8-6-13/h4,9,11,13-14,22H,2-3,5-8,10H2,1H3,(H,20,23) |
| InChIKey | PDUJBBTXNNASIT-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|