C15H16N2O3 — CID 6460881
N-cyclopentyl-2-methyl-1,3-dioxoisoindole-5-carboxamide (PubChem CID 6460881) has the molecular formula C15H16N2O3 and a molecular weight of 272.30 g/mol. Its IUPAC name is N-cyclopentyl-2-methyl-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | N-cyclopentyl-2-methyl-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 6460881 |
| Molecular Formula | C15H16N2O3 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | N-cyclopentyl-2-methyl-1,3-dioxoisoindole-5-carboxamide |
| SMILES | CN1C(=O)c2ccc(C(=O)NC3CCCC3)cc2C1=O |
| InChI | InChI=1S/C15H16N2O3/c1-17-14(19)11-7-6-9(8-12(11)15(17)20)13(18)16-10-4-2-3-5-10/h6-8,10H,2-5H2,1H3,(H,16,18) |
| InChIKey | FDKSORGFQNLZQS-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|