C20H17FN2O3 — CID 9213923
N-cyclopentyl-2-(4-fluorophenyl)-1,3-dioxoisoindole-5-carboxamide (PubChem CID 9213923) has the molecular formula C20H17FN2O3 and a molecular weight of 352.37 g/mol. Its IUPAC name is N-cyclopentyl-2-(4-fluorophenyl)-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | N-cyclopentyl-2-(4-fluorophenyl)-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 9213923 |
| Molecular Formula | C20H17FN2O3 |
| Molecular Weight | 352.37 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | N-cyclopentyl-2-(4-fluorophenyl)-1,3-dioxoisoindole-5-carboxamide |
| SMILES | O=C(NC1CCCC1)c1ccc2c(c1)C(=O)N(c1ccc(F)cc1)C2=O |
| InChI | InChI=1S/C20H17FN2O3/c21-13-6-8-15(9-7-13)23-19(25)16-10-5-12(11-17(16)20(23)26)18(24)22-14-3-1-2-4-14/h5-11,14H,1-4H2,(H,22,24) |
| InChIKey | AZIPZHIDUMUQHH-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.37 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|