C23H16F2N2O3 — CID 8643091
2-(4-fluorophenyl)-N-[2-(2-fluorophenyl)ethyl]-1,3-dioxoisoindole-5-carboxamide (PubChem CID 8643091) has the molecular formula C23H16F2N2O3 and a molecular weight of 406.39 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-[2-(2-fluorophenyl)ethyl]-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | 2-(4-fluorophenyl)-N-[2-(2-fluorophenyl)ethyl]-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 8643091 |
| Molecular Formula | C23H16F2N2O3 |
| Molecular Weight | 406.39 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | 2-(4-fluorophenyl)-N-[2-(2-fluorophenyl)ethyl]-1,3-dioxoisoindole-5-carboxamide |
| SMILES | O=C(NCCc1ccccc1F)c1ccc2c(c1)C(=O)N(c1ccc(F)cc1)C2=O |
| InChI | InChI=1S/C23H16F2N2O3/c24-16-6-8-17(9-7-16)27-22(29)18-10-5-15(13-19(18)23(27)30)21(28)26-12-11-14-3-1-2-4-20(14)25/h1-10,13H,11-12H2,(H,26,28) |
| InChIKey | RGIBXOLSGNALKZ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.39 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|