C23H17FN2O3 — CID 1329424
N-(2-ethylphenyl)-2-(4-fluorophenyl)-1,3-dioxoisoindole-5-carboxamide (PubChem CID 1329424) has the molecular formula C23H17FN2O3 and a molecular weight of 388.40 g/mol. Its IUPAC name is N-(2-ethylphenyl)-2-(4-fluorophenyl)-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | N-(2-ethylphenyl)-2-(4-fluorophenyl)-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 1329424 |
| Molecular Formula | C23H17FN2O3 |
| Molecular Weight | 388.40 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | N-(2-ethylphenyl)-2-(4-fluorophenyl)-1,3-dioxoisoindole-5-carboxamide |
| SMILES | CCc1ccccc1NC(=O)c1ccc2c(c1)C(=O)N(c1ccc(F)cc1)C2=O |
| InChI | InChI=1S/C23H17FN2O3/c1-2-14-5-3-4-6-20(14)25-21(27)15-7-12-18-19(13-15)23(29)26(22(18)28)17-10-8-16(24)9-11-17/h3-13H,2H2,1H3,(H,25,27) |
| InChIKey | URLAYNPPMRCLKD-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.40 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|