C30H22N2O4 — CID 3605111
2-(4-benzoylphenyl)-N-(2,3-dimethylphenyl)-1,3-dioxoisoindole-5-carboxamide (PubChem CID 3605111) has the molecular formula C30H22N2O4 and a molecular weight of 474.52 g/mol. Its IUPAC name is 2-(4-benzoylphenyl)-N-(2,3-dimethylphenyl)-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | 2-(4-benzoylphenyl)-N-(2,3-dimethylphenyl)-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 3605111 |
| Molecular Formula | C30H22N2O4 |
| Molecular Weight | 474.52 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | 2-(4-benzoylphenyl)-N-(2,3-dimethylphenyl)-1,3-dioxoisoindole-5-carboxamide |
| SMILES | Cc1cccc(NC(=O)c2ccc3c(c2)C(=O)N(c2ccc(C(=O)c4ccccc4)cc2)C3=O)c1C |
| InChI | InChI=1S/C30H22N2O4/c1-18-7-6-10-26(19(18)2)31-28(34)22-13-16-24-25(17-22)30(36)32(29(24)35)23-14-11-21(12-15-23)27(33)20-8-4-3-5-9-20/h3-17H,1-2H3,(H,31,34) |
| InChIKey | RROZJEZUDHBUAL-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.52 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|