C22H16N2O5 — CID 1238748
N-(2-hydroxyphenyl)-2-(3-methoxyphenyl)-1,3-dioxoisoindole-5-carboxamide (PubChem CID 1238748) has the molecular formula C22H16N2O5 and a molecular weight of 388.38 g/mol. Its IUPAC name is N-(2-hydroxyphenyl)-2-(3-methoxyphenyl)-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | N-(2-hydroxyphenyl)-2-(3-methoxyphenyl)-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 1238748 |
| Molecular Formula | C22H16N2O5 |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | N-(2-hydroxyphenyl)-2-(3-methoxyphenyl)-1,3-dioxoisoindole-5-carboxamide |
| SMILES | COc1cccc(N2C(=O)c3ccc(C(=O)Nc4ccccc4O)cc3C2=O)c1 |
| InChI | InChI=1S/C22H16N2O5/c1-29-15-6-4-5-14(12-15)24-21(27)16-10-9-13(11-17(16)22(24)28)20(26)23-18-7-2-3-8-19(18)25/h2-12,25H,1H3,(H,23,26) |
| InChIKey | JNUCQLRMRGGZKU-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|