C23H16N2O6 — CID 1342600
[3-[5-[(2-hydroxyphenyl)carbamoyl]-1,3-dioxoisoindol-2-yl]phenyl] acetate (PubChem CID 1342600) has the molecular formula C23H16N2O6 and a molecular weight of 416.39 g/mol. Its IUPAC name is [3-[5-[(2-hydroxyphenyl)carbamoyl]-1,3-dioxoisoindol-2-yl]phenyl] acetate.
| Compound Name | [3-[5-[(2-hydroxyphenyl)carbamoyl]-1,3-dioxoisoindol-2-yl]phenyl] acetate |
|---|---|
| PubChem CID | 1342600 |
| Molecular Formula | C23H16N2O6 |
| Molecular Weight | 416.39 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | [3-[5-[(2-hydroxyphenyl)carbamoyl]-1,3-dioxoisoindol-2-yl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(N2C(=O)c3ccc(C(=O)Nc4ccccc4O)cc3C2=O)c1 |
| InChI | InChI=1S/C23H16N2O6/c1-13(26)31-16-6-4-5-15(12-16)25-22(29)17-10-9-14(11-18(17)23(25)30)21(28)24-19-7-2-3-8-20(19)27/h2-12,27H,1H3,(H,24,28) |
| InChIKey | NFGSSUYJHNQEEX-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.39 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|