C30H23N3O6 — CID 1117009
N-(2-methoxyphenyl)-2-[4-[(2-methoxyphenyl)carbamoyl]phenyl]-1,3-dioxoisoindole-5-carboxamide (PubChem CID 1117009) has the molecular formula C30H23N3O6 and a molecular weight of 521.53 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-2-[4-[(2-methoxyphenyl)carbamoyl]phenyl]-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | N-(2-methoxyphenyl)-2-[4-[(2-methoxyphenyl)carbamoyl]phenyl]-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 1117009 |
| Molecular Formula | C30H23N3O6 |
| Molecular Weight | 521.53 g/mol |
| Exact Mass | 521.16 |
| IUPAC Name | N-(2-methoxyphenyl)-2-[4-[(2-methoxyphenyl)carbamoyl]phenyl]-1,3-dioxoisoindole-5-carboxamide |
| SMILES | COc1ccccc1NC(=O)c1ccc(N2C(=O)c3ccc(C(=O)Nc4ccccc4OC)cc3C2=O)cc1 |
| InChI | InChI=1S/C30H23N3O6/c1-38-25-9-5-3-7-23(25)31-27(34)18-11-14-20(15-12-18)33-29(36)21-16-13-19(17-22(21)30(33)37)28(35)32-24-8-4-6-10-26(24)39-2/h3-17H,1-2H3,(H,31,34)(H,32,35) |
| InChIKey | STIYKUIVXRJUND-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.53 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|