C26H20N2O8 — CID 4644405
dimethyl 2-[[2-(3-methoxyphenyl)-1,3-dioxoisoindole-5-carbonyl]amino]benzene-1,4-dicarboxylate (PubChem CID 4644405) has the molecular formula C26H20N2O8 and a molecular weight of 488.45 g/mol. Its IUPAC name is dimethyl 2-[[2-(3-methoxyphenyl)-1,3-dioxoisoindole-5-carbonyl]amino]benzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2-[[2-(3-methoxyphenyl)-1,3-dioxoisoindole-5-carbonyl]amino]benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 4644405 |
| Molecular Formula | C26H20N2O8 |
| Molecular Weight | 488.45 g/mol |
| Exact Mass | 488.12 |
| IUPAC Name | dimethyl 2-[[2-(3-methoxyphenyl)-1,3-dioxoisoindole-5-carbonyl]amino]benzene-1,4-dicarboxylate |
| SMILES | COC(=O)c1ccc(C(=O)OC)c(NC(=O)c2ccc3c(c2)C(=O)N(c2cccc(OC)c2)C3=O)c1 |
| InChI | InChI=1S/C26H20N2O8/c1-34-17-6-4-5-16(13-17)28-23(30)18-9-7-14(11-20(18)24(28)31)22(29)27-21-12-15(25(32)35-2)8-10-19(21)26(33)36-3/h4-13H,1-3H3,(H,27,29) |
| InChIKey | RNCNKVAGLKBHJU-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 128.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.45 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|