C23H15ClN2O6 — CID 46866790
4-chloro-2-[[2-[3-(hydroxymethyl)phenyl]-1,3-dioxoisoindole-5-carbonyl]amino]benzoic acid (PubChem CID 46866790) has the molecular formula C23H15ClN2O6 and a molecular weight of 450.83 g/mol. Its IUPAC name is 4-chloro-2-[[2-[3-(hydroxymethyl)phenyl]-1,3-dioxoisoindole-5-carbonyl]amino]benzoic acid.
| Compound Name | 4-chloro-2-[[2-[3-(hydroxymethyl)phenyl]-1,3-dioxoisoindole-5-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 46866790 |
| Molecular Formula | C23H15ClN2O6 |
| Molecular Weight | 450.83 g/mol |
| Exact Mass | 450.06 |
| IUPAC Name | 4-chloro-2-[[2-[3-(hydroxymethyl)phenyl]-1,3-dioxoisoindole-5-carbonyl]amino]benzoic acid |
| SMILES | O=C(Nc1cc(Cl)ccc1C(=O)O)c1ccc2c(c1)C(=O)N(c1cccc(CO)c1)C2=O |
| InChI | InChI=1S/C23H15ClN2O6/c24-14-5-7-17(23(31)32)19(10-14)25-20(28)13-4-6-16-18(9-13)22(30)26(21(16)29)15-3-1-2-12(8-15)11-27/h1-10,27H,11H2,(H,25,28)(H,31,32) |
| InChIKey | UGMVQIIKEHRJKR-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.83 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|