C22H13ClN2O6 — CID 46868655
4-chloro-2-[[2-(2-hydroxyphenyl)-1,3-dioxoisoindole-5-carbonyl]amino]benzoic acid (PubChem CID 46868655) has the molecular formula C22H13ClN2O6 and a molecular weight of 436.81 g/mol. Its IUPAC name is 4-chloro-2-[[2-(2-hydroxyphenyl)-1,3-dioxoisoindole-5-carbonyl]amino]benzoic acid.
| Compound Name | 4-chloro-2-[[2-(2-hydroxyphenyl)-1,3-dioxoisoindole-5-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 46868655 |
| Molecular Formula | C22H13ClN2O6 |
| Molecular Weight | 436.81 g/mol |
| Exact Mass | 436.05 |
| IUPAC Name | 4-chloro-2-[[2-(2-hydroxyphenyl)-1,3-dioxoisoindole-5-carbonyl]amino]benzoic acid |
| SMILES | O=C(Nc1cc(Cl)ccc1C(=O)O)c1ccc2c(c1)C(=O)N(c1ccccc1O)C2=O |
| InChI | InChI=1S/C22H13ClN2O6/c23-12-6-8-14(22(30)31)16(10-12)24-19(27)11-5-7-13-15(9-11)21(29)25(20(13)28)17-3-1-2-4-18(17)26/h1-10,26H,(H,24,27)(H,30,31) |
| InChIKey | YZCGUQOGRSEYPK-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.81 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|