C43H22Cl2N2O7 — CID 3110126
2-(2-benzoyl-4-chlorophenyl)-5-[2-(2-benzoyl-4-chlorophenyl)-1,3-dioxoisoindole-5-carbonyl]isoindole-1,3-dione (PubChem CID 3110126) has the molecular formula C43H22Cl2N2O7 and a molecular weight of 749.56 g/mol. Its IUPAC name is 2-(2-benzoyl-4-chlorophenyl)-5-[2-(2-benzoyl-4-chlorophenyl)-1,3-dioxoisoindole-5-carbonyl]isoindole-1,3-dione.
| Compound Name | 2-(2-benzoyl-4-chlorophenyl)-5-[2-(2-benzoyl-4-chlorophenyl)-1,3-dioxoisoindole-5-carbonyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 3110126 |
| Molecular Formula | C43H22Cl2N2O7 |
| Molecular Weight | 749.56 g/mol |
| Exact Mass | 748.08 |
| IUPAC Name | 2-(2-benzoyl-4-chlorophenyl)-5-[2-(2-benzoyl-4-chlorophenyl)-1,3-dioxoisoindole-5-carbonyl]isoindole-1,3-dione |
| SMILES | O=C(c1ccc2c(c1)C(=O)N(c1ccc(Cl)cc1C(=O)c1ccccc1)C2=O)c1ccc2c(c1)C(=O)N(c1ccc(Cl)cc1C(=O)c1ccccc1)C2=O |
| InChI | InChI=1S/C43H22Cl2N2O7/c44-27-13-17-35(33(21-27)38(49)23-7-3-1-4-8-23)46-40(51)29-15-11-25(19-31(29)42(46)53)37(48)26-12-16-30-32(20-26)43(54)47(41(30)52)36-18-14-28(45)22-34(36)39(50)24-9-5-2-6-10-24/h1-22H |
| InChIKey | XQTRJSTUQVNFNC-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 125.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.56 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|