C15H8ClNO5 — CID 777395
2-(5-chloro-2-hydroxyphenyl)-1,3-dioxoisoindole-5-carboxylic acid (PubChem CID 777395) has the molecular formula C15H8ClNO5 and a molecular weight of 317.68 g/mol. Its IUPAC name is 2-(5-chloro-2-hydroxyphenyl)-1,3-dioxoisoindole-5-carboxylic acid.
| Compound Name | 2-(5-chloro-2-hydroxyphenyl)-1,3-dioxoisoindole-5-carboxylic acid |
|---|---|
| PubChem CID | 777395 |
| Molecular Formula | C15H8ClNO5 |
| Molecular Weight | 317.68 g/mol |
| Exact Mass | 317.01 |
| IUPAC Name | 2-(5-chloro-2-hydroxyphenyl)-1,3-dioxoisoindole-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)C(=O)N(c1cc(Cl)ccc1O)C2=O |
| InChI | InChI=1S/C15H8ClNO5/c16-8-2-4-12(18)11(6-8)17-13(19)9-3-1-7(15(21)22)5-10(9)14(17)20/h1-6,18H,(H,21,22) |
| InChIKey | NGRNQTMCUBNKPJ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.68 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|