C32H20N2O8 — CID 102007666
2-[4-[4-(5-carboxy-1,3-dioxoisoindol-2-yl)-3-methylphenyl]-2-methylphenyl]-1,3-dioxoisoindole-5-carboxylic acid (PubChem CID 102007666) has the molecular formula C32H20N2O8 and a molecular weight of 560.52 g/mol. Its IUPAC name is 2-[4-[4-(5-carboxy-1,3-dioxoisoindol-2-yl)-3-methylphenyl]-2-methylphenyl]-1,3-dioxoisoindole-5-carboxylic acid.
| Compound Name | 2-[4-[4-(5-carboxy-1,3-dioxoisoindol-2-yl)-3-methylphenyl]-2-methylphenyl]-1,3-dioxoisoindole-5-carboxylic acid |
|---|---|
| PubChem CID | 102007666 |
| Molecular Formula | C32H20N2O8 |
| Molecular Weight | 560.52 g/mol |
| Exact Mass | 560.12 |
| IUPAC Name | 2-[4-[4-(5-carboxy-1,3-dioxoisoindol-2-yl)-3-methylphenyl]-2-methylphenyl]-1,3-dioxoisoindole-5-carboxylic acid |
| SMILES | Cc1cc(-c2ccc(N3C(=O)c4ccc(C(=O)O)cc4C3=O)c(C)c2)ccc1N1C(=O)c2ccc(C(=O)O)cc2C1=O |
| InChI | InChI=1S/C32H20N2O8/c1-15-11-17(5-9-25(15)33-27(35)21-7-3-19(31(39)40)13-23(21)29(33)37)18-6-10-26(16(2)12-18)34-28(36)22-8-4-20(32(41)42)14-24(22)30(34)38/h3-14H,1-2H3,(H,39,40)(H,41,42) |
| InChIKey | HBRCFXOVSMGIBT-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 149.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.52 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|