C16H10FNO4 — CID 23792936
2-(5-fluoro-2-methylphenyl)-1,3-dioxoisoindole-5-carboxylic acid (PubChem CID 23792936) has the molecular formula C16H10FNO4 and a molecular weight of 299.26 g/mol. Its IUPAC name is 2-(5-fluoro-2-methylphenyl)-1,3-dioxoisoindole-5-carboxylic acid.
| Compound Name | 2-(5-fluoro-2-methylphenyl)-1,3-dioxoisoindole-5-carboxylic acid |
|---|---|
| PubChem CID | 23792936 |
| Molecular Formula | C16H10FNO4 |
| Molecular Weight | 299.26 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | 2-(5-fluoro-2-methylphenyl)-1,3-dioxoisoindole-5-carboxylic acid |
| SMILES | Cc1ccc(F)cc1N1C(=O)c2ccc(C(=O)O)cc2C1=O |
| InChI | InChI=1S/C16H10FNO4/c1-8-2-4-10(17)7-13(8)18-14(19)11-5-3-9(16(21)22)6-12(11)15(18)20/h2-7H,1H3,(H,21,22) |
| InChIKey | QVDGXPSCTTXIBY-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.26 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|