C25H18N2O7 — CID 1036032
5-[[2-(2,4-dimethylphenyl)-1,3-dioxoisoindole-5-carbonyl]amino]benzene-1,3-dicarboxylic acid (PubChem CID 1036032) has the molecular formula C25H18N2O7 and a molecular weight of 458.43 g/mol. Its IUPAC name is 5-[[2-(2,4-dimethylphenyl)-1,3-dioxoisoindole-5-carbonyl]amino]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[[2-(2,4-dimethylphenyl)-1,3-dioxoisoindole-5-carbonyl]amino]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 1036032 |
| Molecular Formula | C25H18N2O7 |
| Molecular Weight | 458.43 g/mol |
| Exact Mass | 458.11 |
| IUPAC Name | 5-[[2-(2,4-dimethylphenyl)-1,3-dioxoisoindole-5-carbonyl]amino]benzene-1,3-dicarboxylic acid |
| SMILES | Cc1ccc(N2C(=O)c3ccc(C(=O)Nc4cc(C(=O)O)cc(C(=O)O)c4)cc3C2=O)c(C)c1 |
| InChI | InChI=1S/C25H18N2O7/c1-12-3-6-20(13(2)7-12)27-22(29)18-5-4-14(11-19(18)23(27)30)21(28)26-17-9-15(24(31)32)8-16(10-17)25(33)34/h3-11H,1-2H3,(H,26,28)(H,31,32)(H,33,34) |
| InChIKey | LTKOLZXFYRTSJL-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 141.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.43 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|