C25H17N3O5 — CID 5241135
2-(2,4-dimethylphenyl)-N-(1,3-dioxoisoindol-2-yl)-1,3-dioxoisoindole-5-carboxamide (PubChem CID 5241135) has the molecular formula C25H17N3O5 and a molecular weight of 439.43 g/mol. Its IUPAC name is 2-(2,4-dimethylphenyl)-N-(1,3-dioxoisoindol-2-yl)-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | 2-(2,4-dimethylphenyl)-N-(1,3-dioxoisoindol-2-yl)-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 5241135 |
| Molecular Formula | C25H17N3O5 |
| Molecular Weight | 439.43 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | 2-(2,4-dimethylphenyl)-N-(1,3-dioxoisoindol-2-yl)-1,3-dioxoisoindole-5-carboxamide |
| SMILES | Cc1ccc(N2C(=O)c3ccc(C(=O)NN4C(=O)c5ccccc5C4=O)cc3C2=O)c(C)c1 |
| InChI | InChI=1S/C25H17N3O5/c1-13-7-10-20(14(2)11-13)27-22(30)18-9-8-15(12-19(18)23(27)31)21(29)26-28-24(32)16-5-3-4-6-17(16)25(28)33/h3-12H,1-2H3,(H,26,29) |
| InChIKey | DDGNVKYIQOCWMQ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.43 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|