C24H19N3O4 — CID 108762777
N-(3-cyano-4,5-dimethylfuran-2-yl)-2-(2,4-dimethylphenyl)-1,3-dioxoisoindole-5-carboxamide (PubChem CID 108762777) has the molecular formula C24H19N3O4 and a molecular weight of 413.43 g/mol. Its IUPAC name is N-(3-cyano-4,5-dimethylfuran-2-yl)-2-(2,4-dimethylphenyl)-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | N-(3-cyano-4,5-dimethylfuran-2-yl)-2-(2,4-dimethylphenyl)-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 108762777 |
| Molecular Formula | C24H19N3O4 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | N-(3-cyano-4,5-dimethylfuran-2-yl)-2-(2,4-dimethylphenyl)-1,3-dioxoisoindole-5-carboxamide |
| SMILES | Cc1ccc(N2C(=O)c3ccc(C(=O)Nc4oc(C)c(C)c4C#N)cc3C2=O)c(C)c1 |
| InChI | InChI=1S/C24H19N3O4/c1-12-5-8-20(13(2)9-12)27-23(29)17-7-6-16(10-18(17)24(27)30)21(28)26-22-19(11-25)14(3)15(4)31-22/h5-10H,1-4H3,(H,26,28) |
| InChIKey | PUAYBMVNKBHDLA-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 103.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|