C29H24N4O4 — CID 108764944
2-(2,4-dimethylphenyl)-N-[4-(4,6-dimethylpyrimidin-2-yl)oxyphenyl]-1,3-dioxoisoindole-5-carboxamide (PubChem CID 108764944) has the molecular formula C29H24N4O4 and a molecular weight of 492.54 g/mol. Its IUPAC name is 2-(2,4-dimethylphenyl)-N-[4-(4,6-dimethylpyrimidin-2-yl)oxyphenyl]-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | 2-(2,4-dimethylphenyl)-N-[4-(4,6-dimethylpyrimidin-2-yl)oxyphenyl]-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 108764944 |
| Molecular Formula | C29H24N4O4 |
| Molecular Weight | 492.54 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | 2-(2,4-dimethylphenyl)-N-[4-(4,6-dimethylpyrimidin-2-yl)oxyphenyl]-1,3-dioxoisoindole-5-carboxamide |
| SMILES | Cc1ccc(N2C(=O)c3ccc(C(=O)Nc4ccc(Oc5nc(C)cc(C)n5)cc4)cc3C2=O)c(C)c1 |
| InChI | InChI=1S/C29H24N4O4/c1-16-5-12-25(17(2)13-16)33-27(35)23-11-6-20(15-24(23)28(33)36)26(34)32-21-7-9-22(10-8-21)37-29-30-18(3)14-19(4)31-29/h5-15H,1-4H3,(H,32,34) |
| InChIKey | APTOPMKHGMLTMD-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.54 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|