C28H25N3O5 — CID 127040271
2-[5-[(4-methylphenyl)carbamoyl]-2-piperidin-1-ylphenyl]-1,3-dioxoisoindole-5-carboxylic acid (PubChem CID 127040271) has the molecular formula C28H25N3O5 and a molecular weight of 483.52 g/mol. Its IUPAC name is 2-[5-[(4-methylphenyl)carbamoyl]-2-piperidin-1-ylphenyl]-1,3-dioxoisoindole-5-carboxylic acid.
| Compound Name | 2-[5-[(4-methylphenyl)carbamoyl]-2-piperidin-1-ylphenyl]-1,3-dioxoisoindole-5-carboxylic acid |
|---|---|
| PubChem CID | 127040271 |
| Molecular Formula | C28H25N3O5 |
| Molecular Weight | 483.52 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | 2-[5-[(4-methylphenyl)carbamoyl]-2-piperidin-1-ylphenyl]-1,3-dioxoisoindole-5-carboxylic acid |
| SMILES | Cc1ccc(NC(=O)c2ccc(N3CCCCC3)c(N3C(=O)c4ccc(C(=O)O)cc4C3=O)c2)cc1 |
| InChI | InChI=1S/C28H25N3O5/c1-17-5-9-20(10-6-17)29-25(32)18-8-12-23(30-13-3-2-4-14-30)24(16-18)31-26(33)21-11-7-19(28(35)36)15-22(21)27(31)34/h5-12,15-16H,2-4,13-14H2,1H3,(H,29,32)(H,35,36) |
| InChIKey | RETNZVYNEZYPFO-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.52 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|