C30H31N3O3 — CID 108760658
2-(2,4-dimethylphenyl)-N-[4-[(4-methylpiperidin-1-yl)methyl]phenyl]-1,3-dioxoisoindole-5-carboxamide (PubChem CID 108760658) has the molecular formula C30H31N3O3 and a molecular weight of 481.60 g/mol. Its IUPAC name is 2-(2,4-dimethylphenyl)-N-[4-[(4-methylpiperidin-1-yl)methyl]phenyl]-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | 2-(2,4-dimethylphenyl)-N-[4-[(4-methylpiperidin-1-yl)methyl]phenyl]-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 108760658 |
| Molecular Formula | C30H31N3O3 |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.24 |
| IUPAC Name | 2-(2,4-dimethylphenyl)-N-[4-[(4-methylpiperidin-1-yl)methyl]phenyl]-1,3-dioxoisoindole-5-carboxamide |
| SMILES | Cc1ccc(N2C(=O)c3ccc(C(=O)Nc4ccc(CN5CCC(C)CC5)cc4)cc3C2=O)c(C)c1 |
| InChI | InChI=1S/C30H31N3O3/c1-19-12-14-32(15-13-19)18-22-5-8-24(9-6-22)31-28(34)23-7-10-25-26(17-23)30(36)33(29(25)35)27-11-4-20(2)16-21(27)3/h4-11,16-17,19H,12-15,18H2,1-3H3,(H,31,34) |
| InChIKey | JQJWMUMPVJDDQW-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|