C26H22N2O3 — CID 40706621
N-(2,3-dihydro-1H-inden-5-yl)-2-(2,5-dimethylphenyl)-1,3-dioxoisoindole-5-carboxamide (PubChem CID 40706621) has the molecular formula C26H22N2O3 and a molecular weight of 410.47 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-inden-5-yl)-2-(2,5-dimethylphenyl)-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | N-(2,3-dihydro-1H-inden-5-yl)-2-(2,5-dimethylphenyl)-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 40706621 |
| Molecular Formula | C26H22N2O3 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | N-(2,3-dihydro-1H-inden-5-yl)-2-(2,5-dimethylphenyl)-1,3-dioxoisoindole-5-carboxamide |
| SMILES | Cc1ccc(C)c(N2C(=O)c3ccc(C(=O)Nc4ccc5c(c4)CCC5)cc3C2=O)c1 |
| InChI | InChI=1S/C26H22N2O3/c1-15-6-7-16(2)23(12-15)28-25(30)21-11-9-19(14-22(21)26(28)31)24(29)27-20-10-8-17-4-3-5-18(17)13-20/h6-14H,3-5H2,1-2H3,(H,27,29) |
| InChIKey | VHDXDKFTHJBIRX-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|