C20H22ClN3O3 — CID 119504031
2-(2,5-dimethylphenyl)-N-[2-(methylamino)ethyl]-1,3-dioxoisoindole-5-carboxamide;hydrochloride (PubChem CID 119504031) has the molecular formula C20H22ClN3O3 and a molecular weight of 387.87 g/mol. Its IUPAC name is 2-(2,5-dimethylphenyl)-N-[2-(methylamino)ethyl]-1,3-dioxoisoindole-5-carboxamide;hydrochloride.
| Compound Name | 2-(2,5-dimethylphenyl)-N-[2-(methylamino)ethyl]-1,3-dioxoisoindole-5-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119504031 |
| Molecular Formula | C20H22ClN3O3 |
| Molecular Weight | 387.87 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 2-(2,5-dimethylphenyl)-N-[2-(methylamino)ethyl]-1,3-dioxoisoindole-5-carboxamide;hydrochloride |
| SMILES | CNCCNC(=O)c1ccc2c(c1)C(=O)N(c1cc(C)ccc1C)C2=O.Cl |
| InChI | InChI=1S/C20H21N3O3.ClH/c1-12-4-5-13(2)17(10-12)23-19(25)15-7-6-14(11-16(15)20(23)26)18(24)22-9-8-21-3;/h4-7,10-11,21H,8-9H2,1-3H3,(H,22,24);1H |
| InChIKey | XKKJJZDLTAKTJJ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.87 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|