C21H24ClN3O3 — CID 119630318
N-(2-amino-2-methylpropyl)-2-(2,5-dimethylphenyl)-1,3-dioxoisoindole-5-carboxamide;hydrochloride (PubChem CID 119630318) has the molecular formula C21H24ClN3O3 and a molecular weight of 401.89 g/mol. Its IUPAC name is N-(2-amino-2-methylpropyl)-2-(2,5-dimethylphenyl)-1,3-dioxoisoindole-5-carboxamide;hydrochloride.
| Compound Name | N-(2-amino-2-methylpropyl)-2-(2,5-dimethylphenyl)-1,3-dioxoisoindole-5-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119630318 |
| Molecular Formula | C21H24ClN3O3 |
| Molecular Weight | 401.89 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | N-(2-amino-2-methylpropyl)-2-(2,5-dimethylphenyl)-1,3-dioxoisoindole-5-carboxamide;hydrochloride |
| SMILES | Cc1ccc(C)c(N2C(=O)c3ccc(C(=O)NCC(C)(C)N)cc3C2=O)c1.Cl |
| InChI | InChI=1S/C21H23N3O3.ClH/c1-12-5-6-13(2)17(9-12)24-19(26)15-8-7-14(10-16(15)20(24)27)18(25)23-11-21(3,4)22;/h5-10H,11,22H2,1-4H3,(H,23,25);1H |
| InChIKey | MEIXCSCYCQHBPP-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.89 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|