C38H31N3O5 — CID 3938030
N-(3,4-dimethylphenyl)-2-[4-[4-[(3,4-dimethylphenyl)carbamoyl]phenoxy]phenyl]-1,3-dioxoisoindole-5-carboxamide (PubChem CID 3938030) has the molecular formula C38H31N3O5 and a molecular weight of 609.68 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-2-[4-[4-[(3,4-dimethylphenyl)carbamoyl]phenoxy]phenyl]-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | N-(3,4-dimethylphenyl)-2-[4-[4-[(3,4-dimethylphenyl)carbamoyl]phenoxy]phenyl]-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 3938030 |
| Molecular Formula | C38H31N3O5 |
| Molecular Weight | 609.68 g/mol |
| Exact Mass | 609.23 |
| IUPAC Name | N-(3,4-dimethylphenyl)-2-[4-[4-[(3,4-dimethylphenyl)carbamoyl]phenoxy]phenyl]-1,3-dioxoisoindole-5-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2ccc(Oc3ccc(N4C(=O)c5ccc(C(=O)Nc6ccc(C)c(C)c6)cc5C4=O)cc3)cc2)cc1C |
| InChI | InChI=1S/C38H31N3O5/c1-22-5-10-28(19-24(22)3)39-35(42)26-7-14-31(15-8-26)46-32-16-12-30(13-17-32)41-37(44)33-18-9-27(21-34(33)38(41)45)36(43)40-29-11-6-23(2)25(4)20-29/h5-21H,1-4H3,(H,39,42)(H,40,43) |
| InChIKey | GDDTZKRRGTUYPC-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.68 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|