C23H15BrN2O6 — CID 17172389
2-[4-[[2-(4-bromophenyl)-1,3-dioxoisoindole-5-carbonyl]amino]phenoxy]acetic acid (PubChem CID 17172389) has the molecular formula C23H15BrN2O6 and a molecular weight of 495.29 g/mol. Its IUPAC name is 2-[4-[[2-(4-bromophenyl)-1,3-dioxoisoindole-5-carbonyl]amino]phenoxy]acetic acid.
| Compound Name | 2-[4-[[2-(4-bromophenyl)-1,3-dioxoisoindole-5-carbonyl]amino]phenoxy]acetic acid |
|---|---|
| PubChem CID | 17172389 |
| Molecular Formula | C23H15BrN2O6 |
| Molecular Weight | 495.29 g/mol |
| Exact Mass | 494.01 |
| IUPAC Name | 2-[4-[[2-(4-bromophenyl)-1,3-dioxoisoindole-5-carbonyl]amino]phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(NC(=O)c2ccc3c(c2)C(=O)N(c2ccc(Br)cc2)C3=O)cc1 |
| InChI | InChI=1S/C23H15BrN2O6/c24-14-2-6-16(7-3-14)26-22(30)18-10-1-13(11-19(18)23(26)31)21(29)25-15-4-8-17(9-5-15)32-12-20(27)28/h1-11H,12H2,(H,25,29)(H,27,28) |
| InChIKey | CCWGFZPQVKSMMS-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.29 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|