C31H21N3O5 — CID 153454442
4-methyl-N-[4-[5-(2-methyl-1,3-dioxoisoindol-5-yl)-1,3-dioxoisoindol-2-yl]phenyl]benzamide (PubChem CID 153454442) has the molecular formula C31H21N3O5 and a molecular weight of 515.53 g/mol. Its IUPAC name is 4-methyl-N-[4-[5-(2-methyl-1,3-dioxoisoindol-5-yl)-1,3-dioxoisoindol-2-yl]phenyl]benzamide.
| Compound Name | 4-methyl-N-[4-[5-(2-methyl-1,3-dioxoisoindol-5-yl)-1,3-dioxoisoindol-2-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 153454442 |
| Molecular Formula | C31H21N3O5 |
| Molecular Weight | 515.53 g/mol |
| Exact Mass | 515.15 |
| IUPAC Name | 4-methyl-N-[4-[5-(2-methyl-1,3-dioxoisoindol-5-yl)-1,3-dioxoisoindol-2-yl]phenyl]benzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(N3C(=O)c4ccc(-c5ccc6c(c5)C(=O)N(C)C6=O)cc4C3=O)cc2)cc1 |
| InChI | InChI=1S/C31H21N3O5/c1-17-3-5-18(6-4-17)27(35)32-21-9-11-22(12-10-21)34-30(38)24-14-8-20(16-26(24)31(34)39)19-7-13-23-25(15-19)29(37)33(2)28(23)36/h3-16H,1-2H3,(H,32,35) |
| InChIKey | RZYWKNSGGWIBNC-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.53 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|