C27H18ClN3O4 — CID 23908930
3-amino-N-[2-[4-(4-chlorophenoxy)phenyl]-1,3-dioxoisoindol-5-yl]benzamide (PubChem CID 23908930) has the molecular formula C27H18ClN3O4 and a molecular weight of 483.91 g/mol. Its IUPAC name is 3-amino-N-[2-[4-(4-chlorophenoxy)phenyl]-1,3-dioxoisoindol-5-yl]benzamide.
| Compound Name | 3-amino-N-[2-[4-(4-chlorophenoxy)phenyl]-1,3-dioxoisoindol-5-yl]benzamide |
|---|---|
| PubChem CID | 23908930 |
| Molecular Formula | C27H18ClN3O4 |
| Molecular Weight | 483.91 g/mol |
| Exact Mass | 483.10 |
| IUPAC Name | 3-amino-N-[2-[4-(4-chlorophenoxy)phenyl]-1,3-dioxoisoindol-5-yl]benzamide |
| SMILES | Nc1cccc(C(=O)Nc2ccc3c(c2)C(=O)N(c2ccc(Oc4ccc(Cl)cc4)cc2)C3=O)c1 |
| InChI | InChI=1S/C27H18ClN3O4/c28-17-4-9-21(10-5-17)35-22-11-7-20(8-12-22)31-26(33)23-13-6-19(15-24(23)27(31)34)30-25(32)16-2-1-3-18(29)14-16/h1-15H,29H2,(H,30,32) |
| InChIKey | PFBWOOMOHLFLTN-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.91 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|