C26H28N2O5 — CID 108767524
methyl 2-[[[2-(2,4-dimethylphenyl)-1,3-dioxoisoindole-5-carbonyl]amino]methyl]cyclohexane-1-carboxylate (PubChem CID 108767524) has the molecular formula C26H28N2O5 and a molecular weight of 448.52 g/mol. Its IUPAC name is methyl 2-[[[2-(2,4-dimethylphenyl)-1,3-dioxoisoindole-5-carbonyl]amino]methyl]cyclohexane-1-carboxylate.
| Compound Name | methyl 2-[[[2-(2,4-dimethylphenyl)-1,3-dioxoisoindole-5-carbonyl]amino]methyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 108767524 |
| Molecular Formula | C26H28N2O5 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | methyl 2-[[[2-(2,4-dimethylphenyl)-1,3-dioxoisoindole-5-carbonyl]amino]methyl]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1CCCCC1CNC(=O)c1ccc2c(c1)C(=O)N(c1ccc(C)cc1C)C2=O |
| InChI | InChI=1S/C26H28N2O5/c1-15-8-11-22(16(2)12-15)28-24(30)20-10-9-17(13-21(20)25(28)31)23(29)27-14-18-6-4-5-7-19(18)26(32)33-3/h8-13,18-19H,4-7,14H2,1-3H3,(H,27,29) |
| InChIKey | FWCPTOKBFBGAGU-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|