C24H25N3O4 — CID 154835274
2-(2,5-dimethylphenyl)-N-[2-(methylcarbamoyl)cyclopentyl]-1,3-dioxoisoindole-5-carboxamide (PubChem CID 154835274) has the molecular formula C24H25N3O4 and a molecular weight of 419.48 g/mol. Its IUPAC name is 2-(2,5-dimethylphenyl)-N-[2-(methylcarbamoyl)cyclopentyl]-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | 2-(2,5-dimethylphenyl)-N-[2-(methylcarbamoyl)cyclopentyl]-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 154835274 |
| Molecular Formula | C24H25N3O4 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | 2-(2,5-dimethylphenyl)-N-[2-(methylcarbamoyl)cyclopentyl]-1,3-dioxoisoindole-5-carboxamide |
| SMILES | CNC(=O)C1CCCC1NC(=O)c1ccc2c(c1)C(=O)N(c1cc(C)ccc1C)C2=O |
| InChI | InChI=1S/C24H25N3O4/c1-13-7-8-14(2)20(11-13)27-23(30)16-10-9-15(12-18(16)24(27)31)21(28)26-19-6-4-5-17(19)22(29)25-3/h7-12,17,19H,4-6H2,1-3H3,(H,25,29)(H,26,28) |
| InChIKey | HQHVUPGPWWLZFF-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|