C24H17N3O3S2 — CID 108764600
2-(2,4-dimethylphenyl)-1,3-dioxo-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)isoindole-5-carboxamide (PubChem CID 108764600) has the molecular formula C24H17N3O3S2 and a molecular weight of 459.55 g/mol. Its IUPAC name is 2-(2,4-dimethylphenyl)-1,3-dioxo-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)isoindole-5-carboxamide.
| Compound Name | 2-(2,4-dimethylphenyl)-1,3-dioxo-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)isoindole-5-carboxamide |
|---|---|
| PubChem CID | 108764600 |
| Molecular Formula | C24H17N3O3S2 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.07 |
| IUPAC Name | 2-(2,4-dimethylphenyl)-1,3-dioxo-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)isoindole-5-carboxamide |
| SMILES | Cc1ccc(N2C(=O)c3ccc(C(=O)Nc4nc(-c5cccs5)cs4)cc3C2=O)c(C)c1 |
| InChI | InChI=1S/C24H17N3O3S2/c1-13-5-8-19(14(2)10-13)27-22(29)16-7-6-15(11-17(16)23(27)30)21(28)26-24-25-18(12-32-24)20-4-3-9-31-20/h3-12H,1-2H3,(H,25,26,28) |
| InChIKey | ABVJPGCNIQOTOC-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|