C12H8N2O2S2 — CID 31845736
N-(4-thiophen-2-yl-1,3-thiazol-2-yl)furan-3-carboxamide (PubChem CID 31845736) has the molecular formula C12H8N2O2S2 and a molecular weight of 276.34 g/mol. Its IUPAC name is N-(4-thiophen-2-yl-1,3-thiazol-2-yl)furan-3-carboxamide.
| Compound Name | N-(4-thiophen-2-yl-1,3-thiazol-2-yl)furan-3-carboxamide |
|---|---|
| PubChem CID | 31845736 |
| Molecular Formula | C12H8N2O2S2 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.00 |
| IUPAC Name | N-(4-thiophen-2-yl-1,3-thiazol-2-yl)furan-3-carboxamide |
| SMILES | O=C(Nc1nc(-c2cccs2)cs1)c1ccoc1 |
| InChI | InChI=1S/C12H8N2O2S2/c15-11(8-3-4-16-6-8)14-12-13-9(7-18-12)10-2-1-5-17-10/h1-7H,(H,13,14,15) |
| InChIKey | ZHULTGLNSSIRCC-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |