C16H14N2OS3 — CID 7579191
4-ethylsulfanyl-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)benzamide (PubChem CID 7579191) has the molecular formula C16H14N2OS3 and a molecular weight of 346.50 g/mol. Its IUPAC name is 4-ethylsulfanyl-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)benzamide.
| Compound Name | 4-ethylsulfanyl-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 7579191 |
| Molecular Formula | C16H14N2OS3 |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.03 |
| IUPAC Name | 4-ethylsulfanyl-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)benzamide |
| SMILES | CCSc1ccc(C(=O)Nc2nc(-c3cccs3)cs2)cc1 |
| InChI | InChI=1S/C16H14N2OS3/c1-2-20-12-7-5-11(6-8-12)15(19)18-16-17-13(10-22-16)14-4-3-9-21-14/h3-10H,2H2,1H3,(H,17,18,19) |
| InChIKey | JGWUXNACTABSJJ-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |