C18H18N2OS3 — CID 41086076
4-(4-methylphenyl)sulfanyl-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)butanamide (PubChem CID 41086076) has the molecular formula C18H18N2OS3 and a molecular weight of 374.56 g/mol. Its IUPAC name is 4-(4-methylphenyl)sulfanyl-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)butanamide.
| Compound Name | 4-(4-methylphenyl)sulfanyl-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 41086076 |
| Molecular Formula | C18H18N2OS3 |
| Molecular Weight | 374.56 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | 4-(4-methylphenyl)sulfanyl-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)butanamide |
| SMILES | Cc1ccc(SCCCC(=O)Nc2nc(-c3cccs3)cs2)cc1 |
| InChI | InChI=1S/C18H18N2OS3/c1-13-6-8-14(9-7-13)22-10-3-5-17(21)20-18-19-15(12-24-18)16-4-2-11-23-16/h2,4,6-9,11-12H,3,5,10H2,1H3,(H,19,20,21) |
| InChIKey | MBTNLCRIXMNBCR-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.56 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|