C21H20N4O2S4 — CID 112830370
3-methyl-N,N'-bis(4-thiophen-2-yl-1,3-thiazol-2-yl)hexanediamide (PubChem CID 112830370) has the molecular formula C21H20N4O2S4 and a molecular weight of 488.69 g/mol. Its IUPAC name is 3-methyl-N,N'-bis(4-thiophen-2-yl-1,3-thiazol-2-yl)hexanediamide.
| Compound Name | 3-methyl-N,N'-bis(4-thiophen-2-yl-1,3-thiazol-2-yl)hexanediamide |
|---|---|
| PubChem CID | 112830370 |
| Molecular Formula | C21H20N4O2S4 |
| Molecular Weight | 488.69 g/mol |
| Exact Mass | 488.05 |
| IUPAC Name | 3-methyl-N,N'-bis(4-thiophen-2-yl-1,3-thiazol-2-yl)hexanediamide |
| SMILES | CC(CCC(=O)Nc1nc(-c2cccs2)cs1)CC(=O)Nc1nc(-c2cccs2)cs1 |
| InChI | InChI=1S/C21H20N4O2S4/c1-13(10-19(27)25-21-23-15(12-31-21)17-5-3-9-29-17)6-7-18(26)24-20-22-14(11-30-20)16-4-2-8-28-16/h2-5,8-9,11-13H,6-7,10H2,1H3,(H,22,24,26)(H,23,25,27) |
| InChIKey | PHORDHRMCKQNQY-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.69 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |