C22H18N2OS2 — CID 4171293
3,3-diphenyl-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)propanamide (PubChem CID 4171293) has the molecular formula C22H18N2OS2 and a molecular weight of 390.53 g/mol. Its IUPAC name is 3,3-diphenyl-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)propanamide.
| Compound Name | 3,3-diphenyl-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 4171293 |
| Molecular Formula | C22H18N2OS2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | 3,3-diphenyl-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)propanamide |
| SMILES | O=C(CC(c1ccccc1)c1ccccc1)Nc1nc(-c2cccs2)cs1 |
| InChI | InChI=1S/C22H18N2OS2/c25-21(24-22-23-19(15-27-22)20-12-7-13-26-20)14-18(16-8-3-1-4-9-16)17-10-5-2-6-11-17/h1-13,15,18H,14H2,(H,23,24,25) |
| InChIKey | NSCIBNUDICZRGA-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |