C16H14N2O2S2 — CID 7915788
2-(2-methylphenoxy)-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)acetamide (PubChem CID 7915788) has the molecular formula C16H14N2O2S2 and a molecular weight of 330.43 g/mol. Its IUPAC name is 2-(2-methylphenoxy)-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-(2-methylphenoxy)-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 7915788 |
| Molecular Formula | C16H14N2O2S2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | 2-(2-methylphenoxy)-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)acetamide |
| SMILES | Cc1ccccc1OCC(=O)Nc1nc(-c2cccs2)cs1 |
| InChI | InChI=1S/C16H14N2O2S2/c1-11-5-2-3-6-13(11)20-9-15(19)18-16-17-12(10-22-16)14-7-4-8-21-14/h2-8,10H,9H2,1H3,(H,17,18,19) |
| InChIKey | ZUJKSQBRNFDZOA-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |