C17H15FN2O2S2 — CID 55928851
4-(2-fluorophenoxy)-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)butanamide (PubChem CID 55928851) has the molecular formula C17H15FN2O2S2 and a molecular weight of 362.45 g/mol. Its IUPAC name is 4-(2-fluorophenoxy)-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)butanamide.
| Compound Name | 4-(2-fluorophenoxy)-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 55928851 |
| Molecular Formula | C17H15FN2O2S2 |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | 4-(2-fluorophenoxy)-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)butanamide |
| SMILES | O=C(CCCOc1ccccc1F)Nc1nc(-c2cccs2)cs1 |
| InChI | InChI=1S/C17H15FN2O2S2/c18-12-5-1-2-6-14(12)22-9-3-8-16(21)20-17-19-13(11-24-17)15-7-4-10-23-15/h1-2,4-7,10-11H,3,8-9H2,(H,19,20,21) |
| InChIKey | MBZWMLCYHZWJCS-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|