C20H21N3O2S — CID 84560731
4-(2-aminophenoxy)-N-[4-(4-methylphenyl)-1,3-thiazol-2-yl]butanamide (PubChem CID 84560731) has the molecular formula C20H21N3O2S and a molecular weight of 367.47 g/mol. Its IUPAC name is 4-(2-aminophenoxy)-N-[4-(4-methylphenyl)-1,3-thiazol-2-yl]butanamide.
| Compound Name | 4-(2-aminophenoxy)-N-[4-(4-methylphenyl)-1,3-thiazol-2-yl]butanamide |
|---|---|
| PubChem CID | 84560731 |
| Molecular Formula | C20H21N3O2S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 4-(2-aminophenoxy)-N-[4-(4-methylphenyl)-1,3-thiazol-2-yl]butanamide |
| SMILES | Cc1ccc(-c2csc(NC(=O)CCCOc3ccccc3N)n2)cc1 |
| InChI | InChI=1S/C20H21N3O2S/c1-14-8-10-15(11-9-14)17-13-26-20(22-17)23-19(24)7-4-12-25-18-6-3-2-5-16(18)21/h2-3,5-6,8-11,13H,4,7,12,21H2,1H3,(H,22,23,24) |
| InChIKey | QEFZQOMTNNLYAU-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|