C24H26N2O2S — CID 19228141
4-(2-methylphenoxy)-N-[4-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,3-thiazol-2-yl]butanamide (PubChem CID 19228141) has the molecular formula C24H26N2O2S and a molecular weight of 406.55 g/mol. Its IUPAC name is 4-(2-methylphenoxy)-N-[4-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,3-thiazol-2-yl]butanamide.
| Compound Name | 4-(2-methylphenoxy)-N-[4-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,3-thiazol-2-yl]butanamide |
|---|---|
| PubChem CID | 19228141 |
| Molecular Formula | C24H26N2O2S |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | 4-(2-methylphenoxy)-N-[4-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,3-thiazol-2-yl]butanamide |
| SMILES | Cc1ccccc1OCCCC(=O)Nc1nc(-c2ccc3c(c2)CCCC3)cs1 |
| InChI | InChI=1S/C24H26N2O2S/c1-17-7-2-5-10-22(17)28-14-6-11-23(27)26-24-25-21(16-29-24)20-13-12-18-8-3-4-9-19(18)15-20/h2,5,7,10,12-13,15-16H,3-4,6,8-9,11,14H2,1H3,(H,25,26,27) |
| InChIKey | JPHHJCREYMXTRX-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|