C27H31BrN2O2S — CID 19228715
4-(2-bromo-4-tert-butylphenoxy)-N-[4-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,3-thiazol-2-yl]butanamide (PubChem CID 19228715) has the molecular formula C27H31BrN2O2S and a molecular weight of 527.53 g/mol. Its IUPAC name is 4-(2-bromo-4-tert-butylphenoxy)-N-[4-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,3-thiazol-2-yl]butanamide.
| Compound Name | 4-(2-bromo-4-tert-butylphenoxy)-N-[4-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,3-thiazol-2-yl]butanamide |
|---|---|
| PubChem CID | 19228715 |
| Molecular Formula | C27H31BrN2O2S |
| Molecular Weight | 527.53 g/mol |
| Exact Mass | 526.13 |
| IUPAC Name | 4-(2-bromo-4-tert-butylphenoxy)-N-[4-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,3-thiazol-2-yl]butanamide |
| SMILES | CC(C)(C)c1ccc(OCCCC(=O)Nc2nc(-c3ccc4c(c3)CCCC4)cs2)c(Br)c1 |
| InChI | InChI=1S/C27H31BrN2O2S/c1-27(2,3)21-12-13-24(22(28)16-21)32-14-6-9-25(31)30-26-29-23(17-33-26)20-11-10-18-7-4-5-8-19(18)15-20/h10-13,15-17H,4-9,14H2,1-3H3,(H,29,30,31) |
| InChIKey | WUNYHQYNXXZBDG-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.53 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|