C25H28N2O2S — CID 19228226
4-(2,5-dimethylphenoxy)-N-[4-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,3-thiazol-2-yl]butanamide (PubChem CID 19228226) has the molecular formula C25H28N2O2S and a molecular weight of 420.58 g/mol. Its IUPAC name is 4-(2,5-dimethylphenoxy)-N-[4-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,3-thiazol-2-yl]butanamide.
| Compound Name | 4-(2,5-dimethylphenoxy)-N-[4-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,3-thiazol-2-yl]butanamide |
|---|---|
| PubChem CID | 19228226 |
| Molecular Formula | C25H28N2O2S |
| Molecular Weight | 420.58 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | 4-(2,5-dimethylphenoxy)-N-[4-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,3-thiazol-2-yl]butanamide |
| SMILES | Cc1ccc(C)c(OCCCC(=O)Nc2nc(-c3ccc4c(c3)CCCC4)cs2)c1 |
| InChI | InChI=1S/C25H28N2O2S/c1-17-9-10-18(2)23(14-17)29-13-5-8-24(28)27-25-26-22(16-30-25)21-12-11-19-6-3-4-7-20(19)15-21/h9-12,14-16H,3-8,13H2,1-2H3,(H,26,27,28) |
| InChIKey | MOPFYDRXEIRKFX-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.58 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|