C19H16FN3O4S — CID 84560881
N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-4-(2-nitrophenoxy)butanamide (PubChem CID 84560881) has the molecular formula C19H16FN3O4S and a molecular weight of 401.42 g/mol. Its IUPAC name is N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-4-(2-nitrophenoxy)butanamide.
| Compound Name | N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-4-(2-nitrophenoxy)butanamide |
|---|---|
| PubChem CID | 84560881 |
| Molecular Formula | C19H16FN3O4S |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.08 |
| IUPAC Name | N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-4-(2-nitrophenoxy)butanamide |
| SMILES | O=C(CCCOc1ccccc1[N+](=O)[O-])Nc1nc(-c2ccc(F)cc2)cs1 |
| InChI | InChI=1S/C19H16FN3O4S/c20-14-9-7-13(8-10-14)15-12-28-19(21-15)22-18(24)6-3-11-27-17-5-2-1-4-16(17)23(25)26/h1-2,4-5,7-10,12H,3,6,11H2,(H,21,22,24) |
| InChIKey | OXJPANUFHPGZIF-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|